C13H28O2SSi — CID 10850104
S-ethyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanethioate (PubChem CID 10850104) has the molecular formula C13H28O2SSi and a molecular weight of 276.52 g/mol. Its IUPAC name is S-ethyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanethioate.
| Compound Name | S-ethyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanethioate |
|---|---|
| PubChem CID | 10850104 |
| Molecular Formula | C13H28O2SSi |
| Molecular Weight | 276.52 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | S-ethyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanethioate |
| SMILES | CCSC(=O)[C@@H](C)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28O2SSi/c1-9-16-12(14)10(2)11(3)15-17(7,8)13(4,5)6/h10-11H,9H2,1-8H3/t10-,11+/m0/s1 |
| InChIKey | NKZIXFQLYCPALY-WDEREUQCSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|