C12H26O4Si — CID 87165682
(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-ethoxybutanoic acid (PubChem CID 87165682) has the molecular formula C12H26O4Si and a molecular weight of 262.42 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-ethoxybutanoic acid.
| Compound Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-ethoxybutanoic acid |
|---|---|
| PubChem CID | 87165682 |
| Molecular Formula | C12H26O4Si |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-ethoxybutanoic acid |
| SMILES | CCOC(C)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H26O4Si/c1-8-15-9(2)10(11(13)14)16-17(6,7)12(3,4)5/h9-10H,8H2,1-7H3,(H,13,14)/t9?,10-/m0/s1 |
| InChIKey | FWPNWHFKUOEZJH-AXDSSHIGSA-N |
| XLogP | 2.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|