C9H21NO3Si — CID 175475346
1-[tert-butyl(dimethyl)silyl]oxyethylcarbamic acid (PubChem CID 175475346) has the molecular formula C9H21NO3Si and a molecular weight of 219.36 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxyethylcarbamic acid.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxyethylcarbamic acid |
|---|---|
| PubChem CID | 175475346 |
| Molecular Formula | C9H21NO3Si |
| Molecular Weight | 219.36 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxyethylcarbamic acid |
| SMILES | CC(NC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C9H21NO3Si/c1-7(10-8(11)12)13-14(5,6)9(2,3)4/h7,10H,1-6H3,(H,11,12) |
| InChIKey | XXXMCNWYXDSTON-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|