C12H25NO4Si — CID 91752616
[tert-butyl(dimethyl)silyl] 2-(ethoxycarbonylamino)propanoate (PubChem CID 91752616) has the molecular formula C12H25NO4Si and a molecular weight of 275.42 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-(ethoxycarbonylamino)propanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-(ethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 91752616 |
| Molecular Formula | C12H25NO4Si |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-(ethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)NC(C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H25NO4Si/c1-8-16-11(15)13-9(2)10(14)17-18(6,7)12(3,4)5/h9H,8H2,1-7H3,(H,13,15) |
| InChIKey | VFYNXWXELFFSJS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|