C17H35NO4Si — CID 91753755
[tert-butyl(dimethyl)silyl] (2S,3S)-3-methyl-2-(2-methylpropoxycarbonylamino)pentanoate (PubChem CID 91753755) has the molecular formula C17H35NO4Si and a molecular weight of 345.56 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (2S,3S)-3-methyl-2-(2-methylpropoxycarbonylamino)pentanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (2S,3S)-3-methyl-2-(2-methylpropoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 91753755 |
| Molecular Formula | C17H35NO4Si |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (2S,3S)-3-methyl-2-(2-methylpropoxycarbonylamino)pentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)OCC(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H35NO4Si/c1-10-13(4)14(18-16(20)21-11-12(2)3)15(19)22-23(8,9)17(5,6)7/h12-14H,10-11H2,1-9H3,(H,18,20)/t13-,14-/m0/s1 |
| InChIKey | RZVXLGVTQIGIKL-KBPBESRZSA-N |
| XLogP | 4.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|