About 2-methylpropyl N-propan-2-ylcarbamate
2-methylpropyl N-propan-2-ylcarbamate (PubChem CID 20815988) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-methylpropyl N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | 2-methylpropyl N-propan-2-ylcarbamate |
| PubChem CID | 20815988 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 2-methylpropyl N-propan-2-ylcarbamate |
| SMILES | CC(C)COC(=O)NC(C)C |
| InChI | InChI=1S/C8H17NO2/c1-6(2)5-11-8(10)9-7(3)4/h6-7H,5H2,1-4H3,(H,9,10) |
| InChIKey | PUVYLZPTIQVZMQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpropyl N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-propan-2-ylcarbamate?
The IUPAC name of 2-methylpropyl N-propan-2-ylcarbamate (CID 20815988) is 2-methylpropyl N-propan-2-ylcarbamate.
What is the SMILES notation for 2-methylpropyl N-propan-2-ylcarbamate?
The canonical SMILES for 2-methylpropyl N-propan-2-ylcarbamate is CC(C)COC(=O)NC(C)C.
What is the InChIKey of 2-methylpropyl N-propan-2-ylcarbamate?
The InChIKey is PUVYLZPTIQVZMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-6(2)5-11-8(10)9-7(3)4/h6-7H,5H2,1-4H3,(H,9,10).
What are the key properties of 2-methylpropyl N-propan-2-ylcarbamate?
2-methylpropyl N-propan-2-ylcarbamate has a molecular weight of 159.23 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-propan-2-ylcarbamate is sourced from PubChem (CID 20815988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).