C9H20N2O3 — CID 106181066
2-methylpropyl N-(1-amino-3-methoxypropan-2-yl)carbamate (PubChem CID 106181066) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-methylpropyl N-(1-amino-3-methoxypropan-2-yl)carbamate.
| Compound Name | 2-methylpropyl N-(1-amino-3-methoxypropan-2-yl)carbamate |
|---|---|
| PubChem CID | 106181066 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2-methylpropyl N-(1-amino-3-methoxypropan-2-yl)carbamate |
| SMILES | COCC(CN)NC(=O)OCC(C)C |
| InChI | InChI=1S/C9H20N2O3/c1-7(2)5-14-9(12)11-8(4-10)6-13-3/h7-8H,4-6,10H2,1-3H3,(H,11,12) |
| InChIKey | PSXACRWUBVJIDN-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |