C7H16N2O4S — CID 106180213
N-(1-amino-3-methoxypropan-2-yl)-2-methylsulfonylacetamide (PubChem CID 106180213) has the molecular formula C7H16N2O4S and a molecular weight of 224.28 g/mol. Its IUPAC name is N-(1-amino-3-methoxypropan-2-yl)-2-methylsulfonylacetamide.
| Compound Name | N-(1-amino-3-methoxypropan-2-yl)-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 106180213 |
| Molecular Formula | C7H16N2O4S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N-(1-amino-3-methoxypropan-2-yl)-2-methylsulfonylacetamide |
| SMILES | COCC(CN)NC(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C7H16N2O4S/c1-13-4-6(3-8)9-7(10)5-14(2,11)12/h6H,3-5,8H2,1-2H3,(H,9,10) |
| InChIKey | HTTDNJGBDJYUGL-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |