C9H20BNO3 — CID 164924780
CID 164924780 (PubChem CID 164924780) has the molecular formula C9H20BNO3 and a molecular weight of 201.07 g/mol.
| Compound Name | CID 164924780 |
|---|---|
| PubChem CID | 164924780 |
| Molecular Formula | C9H20BNO3 |
| Molecular Weight | 201.07 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | — |
| SMILES | CC.[B]CC(=O)NC(COC)COC |
| InChI | InChI=1S/C7H14BNO3.C2H6/c1-11-4-6(5-12-2)9-7(10)3-8;1-2/h6H,3-5H2,1-2H3,(H,9,10);1-2H3 |
| InChIKey | GUFIQIRAZOVRAB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.07 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|