C7H14ClNO3 — CID 106186140
3-chloro-N-(1-hydroxy-3-methoxypropan-2-yl)propanamide (PubChem CID 106186140) has the molecular formula C7H14ClNO3 and a molecular weight of 195.65 g/mol. Its IUPAC name is 3-chloro-N-(1-hydroxy-3-methoxypropan-2-yl)propanamide.
| Compound Name | 3-chloro-N-(1-hydroxy-3-methoxypropan-2-yl)propanamide |
|---|---|
| PubChem CID | 106186140 |
| Molecular Formula | C7H14ClNO3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 3-chloro-N-(1-hydroxy-3-methoxypropan-2-yl)propanamide |
| SMILES | COCC(CO)NC(=O)CCCl |
| InChI | InChI=1S/C7H14ClNO3/c1-12-5-6(4-10)9-7(11)2-3-8/h6,10H,2-5H2,1H3,(H,9,11) |
| InChIKey | OEWDLRVQVBRCQS-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|