C8H16ClNO3 — CID 65312302
5-chloro-N-(1,3-dihydroxypropan-2-yl)pentanamide (PubChem CID 65312302) has the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. Its IUPAC name is 5-chloro-N-(1,3-dihydroxypropan-2-yl)pentanamide.
| Compound Name | 5-chloro-N-(1,3-dihydroxypropan-2-yl)pentanamide |
|---|---|
| PubChem CID | 65312302 |
| Molecular Formula | C8H16ClNO3 |
| Molecular Weight | 209.67 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 5-chloro-N-(1,3-dihydroxypropan-2-yl)pentanamide |
| SMILES | O=C(CCCCCl)NC(CO)CO |
| InChI | InChI=1S/C8H16ClNO3/c9-4-2-1-3-8(13)10-7(5-11)6-12/h7,11-12H,1-6H2,(H,10,13) |
| InChIKey | HBNUNQTYEWAVQF-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.67 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|