C8H18N2O3 — CID 106188743
(2R)-2-amino-N-(1-hydroxy-3-methoxypropan-2-yl)butanamide (PubChem CID 106188743) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is (2R)-2-amino-N-(1-hydroxy-3-methoxypropan-2-yl)butanamide.
| Compound Name | (2R)-2-amino-N-(1-hydroxy-3-methoxypropan-2-yl)butanamide |
|---|---|
| PubChem CID | 106188743 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | (2R)-2-amino-N-(1-hydroxy-3-methoxypropan-2-yl)butanamide |
| SMILES | CC[C@@H](N)C(=O)NC(CO)COC |
| InChI | InChI=1S/C8H18N2O3/c1-3-7(9)8(12)10-6(4-11)5-13-2/h6-7,11H,3-5,9H2,1-2H3,(H,10,12)/t6?,7-/m1/s1 |
| InChIKey | WOZKTXRGYBTXLE-COBSHVIPSA-N |
| XLogP | -1.15 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |