C8H16N2O4 — CID 107222531
3-amino-4-[[(2S)-1-hydroxybutan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 107222531) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-amino-4-[[(2S)-1-hydroxybutan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[(2S)-1-hydroxybutan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107222531 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 3-amino-4-[[(2S)-1-hydroxybutan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CC[C@@H](CO)NC(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C8H16N2O4/c1-2-5(4-11)10-8(14)6(9)3-7(12)13/h5-6,11H,2-4,9H2,1H3,(H,10,14)(H,12,13)/t5-,6?/m0/s1 |
| InChIKey | AYRBRHMTHRITHH-ZBHICJROSA-N |
| XLogP | -1.32 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |