C9H20N2O2 — CID 107571000
(2S)-2-amino-N-[(2S)-1-hydroxybutan-2-yl]pentanamide (PubChem CID 107571000) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-1-hydroxybutan-2-yl]pentanamide.
| Compound Name | (2S)-2-amino-N-[(2S)-1-hydroxybutan-2-yl]pentanamide |
|---|---|
| PubChem CID | 107571000 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-1-hydroxybutan-2-yl]pentanamide |
| SMILES | CCC[C@H](N)C(=O)N[C@@H](CC)CO |
| InChI | InChI=1S/C9H20N2O2/c1-3-5-8(10)9(13)11-7(4-2)6-12/h7-8,12H,3-6,10H2,1-2H3,(H,11,13)/t7-,8-/m0/s1 |
| InChIKey | BFERBKVTHZNGTR-YUMQZZPRSA-N |
| XLogP | 0.00 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |