C9H20N2O3 — CID 107145775
(2S)-2-amino-N-(1,3-dihydroxypropan-2-yl)hexanamide (PubChem CID 107145775) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2S)-2-amino-N-(1,3-dihydroxypropan-2-yl)hexanamide.
| Compound Name | (2S)-2-amino-N-(1,3-dihydroxypropan-2-yl)hexanamide |
|---|---|
| PubChem CID | 107145775 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (2S)-2-amino-N-(1,3-dihydroxypropan-2-yl)hexanamide |
| SMILES | CCCC[C@H](N)C(=O)NC(CO)CO |
| InChI | InChI=1S/C9H20N2O3/c1-2-3-4-8(10)9(14)11-7(5-12)6-13/h7-8,12-13H,2-6,10H2,1H3,(H,11,14)/t8-/m0/s1 |
| InChIKey | OMDYYXMOZQTGLN-QMMMGPOBSA-N |
| XLogP | -1.03 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |