C10H21NO3 — CID 154697432
N-(1,3-dihydroxypropan-2-yl)-2-methylhexanamide (PubChem CID 154697432) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-2-methylhexanamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-2-methylhexanamide |
|---|---|
| PubChem CID | 154697432 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-2-methylhexanamide |
| SMILES | CCCCC(C)C(=O)NC(CO)CO |
| InChI | InChI=1S/C10H21NO3/c1-3-4-5-8(2)10(14)11-9(6-12)7-13/h8-9,12-13H,3-7H2,1-2H3,(H,11,14) |
| InChIKey | LIJYDQIEFICPOG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |