C12H24BrNO2 — CID 10780106
(2S)-2-bromo-N-[(2R)-1-hydroxy-4-methylpentan-2-yl]hexanamide (PubChem CID 10780106) has the molecular formula C12H24BrNO2 and a molecular weight of 294.23 g/mol. Its IUPAC name is (2S)-2-bromo-N-[(2R)-1-hydroxy-4-methylpentan-2-yl]hexanamide.
| Compound Name | (2S)-2-bromo-N-[(2R)-1-hydroxy-4-methylpentan-2-yl]hexanamide |
|---|---|
| PubChem CID | 10780106 |
| Molecular Formula | C12H24BrNO2 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (2S)-2-bromo-N-[(2R)-1-hydroxy-4-methylpentan-2-yl]hexanamide |
| SMILES | CCCC[C@H](Br)C(=O)N[C@@H](CO)CC(C)C |
| InChI | InChI=1S/C12H24BrNO2/c1-4-5-6-11(13)12(16)14-10(8-15)7-9(2)3/h9-11,15H,4-8H2,1-3H3,(H,14,16)/t10-,11+/m1/s1 |
| InChIKey | QFVZDXIRDKBKFF-MNOVXSKESA-N |
| XLogP | 2.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|