C11H24N2O2 — CID 65228765
2-(aminomethyl)-N-(1-hydroxy-4-methylpentan-2-yl)butanamide (PubChem CID 65228765) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(1-hydroxy-4-methylpentan-2-yl)butanamide.
| Compound Name | 2-(aminomethyl)-N-(1-hydroxy-4-methylpentan-2-yl)butanamide |
|---|---|
| PubChem CID | 65228765 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 2-(aminomethyl)-N-(1-hydroxy-4-methylpentan-2-yl)butanamide |
| SMILES | CCC(CN)C(=O)NC(CO)CC(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-4-9(6-12)11(15)13-10(7-14)5-8(2)3/h8-10,14H,4-7,12H2,1-3H3,(H,13,15) |
| InChIKey | NIYRKCBTXMPHQD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |