C12H25NO2 — CID 61246170
2-ethyl-N-(1-hydroxy-4-methylpentan-2-yl)butanamide (PubChem CID 61246170) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-ethyl-N-(1-hydroxy-4-methylpentan-2-yl)butanamide.
| Compound Name | 2-ethyl-N-(1-hydroxy-4-methylpentan-2-yl)butanamide |
|---|---|
| PubChem CID | 61246170 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 2-ethyl-N-(1-hydroxy-4-methylpentan-2-yl)butanamide |
| SMILES | CCC(CC)C(=O)NC(CO)CC(C)C |
| InChI | InChI=1S/C12H25NO2/c1-5-10(6-2)12(15)13-11(8-14)7-9(3)4/h9-11,14H,5-8H2,1-4H3,(H,13,15) |
| InChIKey | QYWDQAMUXBMHKR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |