C9H19NO3 — CID 59861010
N-(1,4-dihydroxybutan-2-yl)-2-methylbutanamide (PubChem CID 59861010) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is N-(1,4-dihydroxybutan-2-yl)-2-methylbutanamide.
| Compound Name | N-(1,4-dihydroxybutan-2-yl)-2-methylbutanamide |
|---|---|
| PubChem CID | 59861010 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | N-(1,4-dihydroxybutan-2-yl)-2-methylbutanamide |
| SMILES | CCC(C)C(=O)NC(CO)CCO |
| InChI | InChI=1S/C9H19NO3/c1-3-7(2)9(13)10-8(6-12)4-5-11/h7-8,11-12H,3-6H2,1-2H3,(H,10,13) |
| InChIKey | FDSRJQXCGOYGHU-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |