C7H16N2O3 — CID 65314270
2-amino-N-(1,3-dihydroxypropan-2-yl)butanamide (PubChem CID 65314270) has the molecular formula C7H16N2O3 and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-amino-N-(1,3-dihydroxypropan-2-yl)butanamide.
| Compound Name | 2-amino-N-(1,3-dihydroxypropan-2-yl)butanamide |
|---|---|
| PubChem CID | 65314270 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2-amino-N-(1,3-dihydroxypropan-2-yl)butanamide |
| SMILES | CCC(N)C(=O)NC(CO)CO |
| InChI | InChI=1S/C7H16N2O3/c1-2-6(8)7(12)9-5(3-10)4-11/h5-6,10-11H,2-4,8H2,1H3,(H,9,12) |
| InChIKey | VBBFSGOXQKFVOG-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |