C7H16N2O4 — CID 106190983
2-amino-3-[(1-hydroxy-3-methoxypropan-2-yl)amino]propanoic acid (PubChem CID 106190983) has the molecular formula C7H16N2O4 and a molecular weight of 192.21 g/mol. Its IUPAC name is 2-amino-3-[(1-hydroxy-3-methoxypropan-2-yl)amino]propanoic acid.
| Compound Name | 2-amino-3-[(1-hydroxy-3-methoxypropan-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 106190983 |
| Molecular Formula | C7H16N2O4 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 2-amino-3-[(1-hydroxy-3-methoxypropan-2-yl)amino]propanoic acid |
| SMILES | COCC(CO)NCC(N)C(=O)O |
| InChI | InChI=1S/C7H16N2O4/c1-13-4-5(3-10)9-2-6(8)7(11)12/h5-6,9-10H,2-4,8H2,1H3,(H,11,12) |
| InChIKey | BNYRDFIEXLIJSL-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |