[2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite

C7H17N2O5P — CID 144658045

IUPAC[2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite
SMILESCOP(O)OCC(CO)NC(=O)CCN
InChIInChI=1S/C7H17N2O5P/c1-13-15(12)14-5-6(4-10)9-7(11)2-3-8/h6,10,12H,2-5,8H2,1H3,(H,9,11)
InChIKeyAFRIQJHCJIOSDW-UHFFFAOYSA-N
MW240.20 g/mol
LogP-1.31
Rot. Bonds8

About [2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite

[2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite (PubChem CID 144658045) has the molecular formula C7H17N2O5P and a molecular weight of 240.20 g/mol. Its IUPAC name is [2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite.

Molecular Properties

Compound Name[2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite
PubChem CID144658045
Molecular FormulaC7H17N2O5P
Molecular Weight240.20 g/mol
Exact Mass240.09
IUPAC Name[2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite
SMILESCOP(O)OCC(CO)NC(=O)CCN
InChIInChI=1S/C7H17N2O5P/c1-13-15(12)14-5-6(4-10)9-7(11)2-3-8/h6,10,12H,2-5,8H2,1H3,(H,9,11)
InChIKeyAFRIQJHCJIOSDW-UHFFFAOYSA-N
XLogP-1.31
TPSA114.04 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.20
LogP ≤ 5-1.31
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite?
The IUPAC name of [2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite (CID 144658045) is [2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite.
What is the SMILES notation for [2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite?
The canonical SMILES for [2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite is COP(O)OCC(CO)NC(=O)CCN.
What is the InChIKey of [2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite?
The InChIKey is AFRIQJHCJIOSDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N2O5P/c1-13-15(12)14-5-6(4-10)9-7(11)2-3-8/h6,10,12H,2-5,8H2,1H3,(H,9,11).
What are the key properties of [2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite?
[2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite has a molecular weight of 240.20 g/mol, XLogP of -1.31, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite is sourced from PubChem (CID 144658045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).