C7H17N2O5P — CID 144658045
[2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite (PubChem CID 144658045) has the molecular formula C7H17N2O5P and a molecular weight of 240.20 g/mol. Its IUPAC name is [2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite.
| Compound Name | [2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite |
|---|---|
| PubChem CID | 144658045 |
| Molecular Formula | C7H17N2O5P |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | [2-(3-aminopropanoylamino)-3-hydroxypropyl] methyl hydrogen phosphite |
| SMILES | COP(O)OCC(CO)NC(=O)CCN |
| InChI | InChI=1S/C7H17N2O5P/c1-13-15(12)14-5-6(4-10)9-7(11)2-3-8/h6,10,12H,2-5,8H2,1H3,(H,9,11) |
| InChIKey | AFRIQJHCJIOSDW-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|