C22H44N3O7P — CID 156747644
[6-[6-(6-acetamidohexanoylamino)hexanoylamino]-2-(hydroxymethyl)hexyl] methyl hydrogen phosphite (PubChem CID 156747644) has the molecular formula C22H44N3O7P and a molecular weight of 493.58 g/mol. Its IUPAC name is [6-[6-(6-acetamidohexanoylamino)hexanoylamino]-2-(hydroxymethyl)hexyl] methyl hydrogen phosphite.
| Compound Name | [6-[6-(6-acetamidohexanoylamino)hexanoylamino]-2-(hydroxymethyl)hexyl] methyl hydrogen phosphite |
|---|---|
| PubChem CID | 156747644 |
| Molecular Formula | C22H44N3O7P |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | [6-[6-(6-acetamidohexanoylamino)hexanoylamino]-2-(hydroxymethyl)hexyl] methyl hydrogen phosphite |
| SMILES | COP(O)OCC(CO)CCCCNC(=O)CCCCCNC(=O)CCCCCNC(C)=O |
| InChI | InChI=1S/C22H44N3O7P/c1-19(27)23-14-8-3-5-12-21(28)24-15-9-4-6-13-22(29)25-16-10-7-11-20(17-26)18-32-33(30)31-2/h20,26,30H,3-18H2,1-2H3,(H,23,27)(H,24,28)(H,25,29) |
| InChIKey | NTVNKZFVOCMHEF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 146.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|