C12H26FNO3 — CID 168888423
[6-acetamido-2-(hydroxymethyl)hexyl] hypofluorite;propane (PubChem CID 168888423) has the molecular formula C12H26FNO3 and a molecular weight of 251.34 g/mol. Its IUPAC name is [6-acetamido-2-(hydroxymethyl)hexyl] hypofluorite;propane.
| Compound Name | [6-acetamido-2-(hydroxymethyl)hexyl] hypofluorite;propane |
|---|---|
| PubChem CID | 168888423 |
| Molecular Formula | C12H26FNO3 |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | [6-acetamido-2-(hydroxymethyl)hexyl] hypofluorite;propane |
| SMILES | CC(=O)NCCCCC(CO)COF.CCC |
| InChI | InChI=1S/C9H18FNO3.C3H8/c1-8(13)11-5-3-2-4-9(6-12)7-14-10;1-3-2/h9,12H,2-7H2,1H3,(H,11,13);3H2,1-2H3 |
| InChIKey | GQTXRZPTRAZMSP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|