C10H20N2O3 — CID 78438016
methyl 6-acetamido-2-(methylamino)hexanoate (PubChem CID 78438016) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is methyl 6-acetamido-2-(methylamino)hexanoate.
| Compound Name | methyl 6-acetamido-2-(methylamino)hexanoate |
|---|---|
| PubChem CID | 78438016 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | methyl 6-acetamido-2-(methylamino)hexanoate |
| SMILES | CNC(CCCCNC(C)=O)C(=O)OC |
| InChI | InChI=1S/C10H20N2O3/c1-8(13)12-7-5-4-6-9(11-2)10(14)15-3/h9,11H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | OBIZFBBPPUCZLR-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|