C12H23N3O4 — CID 162702217
3-[[6-(acetylamino)-2-((113C)methylamino)hexanoyl]amino]propanoic acid (PubChem CID 162702217) has the molecular formula C12H23N3O4 and a molecular weight of 275.32 g/mol. Its IUPAC name is 3-[[6-(acetylamino)-2-((113C)methylamino)hexanoyl]amino]propanoic acid.
| Compound Name | 3-[[6-(acetylamino)-2-((113C)methylamino)hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 162702217 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | 3-[[6-(acetylamino)-2-((113C)methylamino)hexanoyl]amino]propanoic acid |
| SMILES | [13CH3]NC(CCCCNC([13CH3])=O)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C12H23N3O4/c1-9(16)14-7-4-3-5-10(13-2)12(19)15-8-6-11(17)18/h10,13H,3-8H2,1-2H3,(H,14,16)(H,15,19)(H,17,18)/i1+1,2+1 |
| InChIKey | LPVBGLJGYQNRLG-ZDOIIHCHSA-N |
| XLogP | -0.53 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|