C11H23N3O2 — CID 129308900
7-acetamido-N-methyl-2-(methylamino)heptanamide (PubChem CID 129308900) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is 7-acetamido-N-methyl-2-(methylamino)heptanamide.
| Compound Name | 7-acetamido-N-methyl-2-(methylamino)heptanamide |
|---|---|
| PubChem CID | 129308900 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 7-acetamido-N-methyl-2-(methylamino)heptanamide |
| SMILES | CNC(=O)C(CCCCCNC(C)=O)NC |
| InChI | InChI=1S/C11H23N3O2/c1-9(15)14-8-6-4-5-7-10(12-2)11(16)13-3/h10,12H,4-8H2,1-3H3,(H,13,16)(H,14,15) |
| InChIKey | BJDYZRFDHYTVLS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|