C10H20N4O3 — CID 177168522
2-acetamido-6-(carbamoylamino)-N-methylhexanamide (PubChem CID 177168522) has the molecular formula C10H20N4O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-acetamido-6-(carbamoylamino)-N-methylhexanamide.
| Compound Name | 2-acetamido-6-(carbamoylamino)-N-methylhexanamide |
|---|---|
| PubChem CID | 177168522 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 2-acetamido-6-(carbamoylamino)-N-methylhexanamide |
| SMILES | CNC(=O)C(CCCCNC(N)=O)NC(C)=O |
| InChI | InChI=1S/C10H20N4O3/c1-7(15)14-8(9(16)12-2)5-3-4-6-13-10(11)17/h8H,3-6H2,1-2H3,(H,12,16)(H,14,15)(H3,11,13,17) |
| InChIKey | IYTFFRDPPQCOOJ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|