C26H46IN7O7 — CID 134131007
(2S)-6-acetamido-2-[[(2S)-2-[[(2S)-2,6-diacetamidohexanoyl]amino]-6-[(2-iodoacetyl)amino]hexanoyl]amino]hexanamide (PubChem CID 134131007) has the molecular formula C26H46IN7O7 and a molecular weight of 695.60 g/mol. Its IUPAC name is (2S)-6-acetamido-2-[[(2S)-2-[[(2S)-2,6-diacetamidohexanoyl]amino]-6-[(2-iodoacetyl)amino]hexanoyl]amino]hexanamide.
| Compound Name | (2S)-6-acetamido-2-[[(2S)-2-[[(2S)-2,6-diacetamidohexanoyl]amino]-6-[(2-iodoacetyl)amino]hexanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 134131007 |
| Molecular Formula | C26H46IN7O7 |
| Molecular Weight | 695.60 g/mol |
| Exact Mass | 695.25 |
| IUPAC Name | (2S)-6-acetamido-2-[[(2S)-2-[[(2S)-2,6-diacetamidohexanoyl]amino]-6-[(2-iodoacetyl)amino]hexanoyl]amino]hexanamide |
| SMILES | CC(=O)NCCCC[C@H](NC(=O)[C@H](CCCCNC(=O)CI)NC(=O)[C@H](CCCCNC(C)=O)NC(C)=O)C(N)=O |
| InChI | InChI=1S/C26H46IN7O7/c1-17(35)29-13-7-4-10-20(24(28)39)33-26(41)22(12-6-9-15-31-23(38)16-27)34-25(40)21(32-19(3)37)11-5-8-14-30-18(2)36/h20-22H,4-16H2,1-3H3,(H2,28,39)(H,29,35)(H,30,36)(H,31,38)(H,32,37)(H,33,41)(H,34,40)/t20-,21-,22-/m0/s1 |
| InChIKey | RFAFPNWXSULKEB-FKBYEOEOSA-N |
| XLogP | -0.72 |
| TPSA | 217.69 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.60 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|