C11H18I2N2O3 — CID 118136970
2-iodo-N-[(5S)-5-[(2-iodoacetyl)amino]-6-oxoheptyl]acetamide (PubChem CID 118136970) has the molecular formula C11H18I2N2O3 and a molecular weight of 480.08 g/mol. Its IUPAC name is 2-iodo-N-[(5S)-5-[(2-iodoacetyl)amino]-6-oxoheptyl]acetamide.
| Compound Name | 2-iodo-N-[(5S)-5-[(2-iodoacetyl)amino]-6-oxoheptyl]acetamide |
|---|---|
| PubChem CID | 118136970 |
| Molecular Formula | C11H18I2N2O3 |
| Molecular Weight | 480.08 g/mol |
| Exact Mass | 479.94 |
| IUPAC Name | 2-iodo-N-[(5S)-5-[(2-iodoacetyl)amino]-6-oxoheptyl]acetamide |
| SMILES | CC(=O)[C@H](CCCCNC(=O)CI)NC(=O)CI |
| InChI | InChI=1S/C11H18I2N2O3/c1-8(16)9(15-11(18)7-13)4-2-3-5-14-10(17)6-12/h9H,2-7H2,1H3,(H,14,17)(H,15,18)/t9-/m0/s1 |
| InChIKey | HOHDNRVPPHQBAW-VIFPVBQESA-N |
| XLogP | 1.22 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.08 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|