C16H27N3O7 — CID 170409546
(4S)-4-[[(1S)-1-carboxy-5-(propanoylamino)pentyl]carbamoylamino]-5-oxohexanoic acid (PubChem CID 170409546) has the molecular formula C16H27N3O7 and a molecular weight of 373.41 g/mol. Its IUPAC name is (4S)-4-[[(1S)-1-carboxy-5-(propanoylamino)pentyl]carbamoylamino]-5-oxohexanoic acid.
| Compound Name | (4S)-4-[[(1S)-1-carboxy-5-(propanoylamino)pentyl]carbamoylamino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 170409546 |
| Molecular Formula | C16H27N3O7 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (4S)-4-[[(1S)-1-carboxy-5-(propanoylamino)pentyl]carbamoylamino]-5-oxohexanoic acid |
| SMILES | CCC(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(C)=O)C(=O)O |
| InChI | InChI=1S/C16H27N3O7/c1-3-13(21)17-9-5-4-6-12(15(24)25)19-16(26)18-11(10(2)20)7-8-14(22)23/h11-12H,3-9H2,1-2H3,(H,17,21)(H,22,23)(H,24,25)(H2,18,19,26)/t11-,12-/m0/s1 |
| InChIKey | WFTAWXMMEICIQJ-RYUDHWBXSA-N |
| XLogP | 0.26 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|