C13H23N3O7 — CID 146551255
(2S)-2-[[1-carboxy-5-(methylamino)pentyl]carbamoylamino]pentanedioic acid (PubChem CID 146551255) has the molecular formula C13H23N3O7 and a molecular weight of 333.34 g/mol. Its IUPAC name is (2S)-2-[[1-carboxy-5-(methylamino)pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[1-carboxy-5-(methylamino)pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 146551255 |
| Molecular Formula | C13H23N3O7 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (2S)-2-[[1-carboxy-5-(methylamino)pentyl]carbamoylamino]pentanedioic acid |
| SMILES | CNCCCCC(NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H23N3O7/c1-14-7-3-2-4-8(11(19)20)15-13(23)16-9(12(21)22)5-6-10(17)18/h8-9,14H,2-7H2,1H3,(H,17,18)(H,19,20)(H,21,22)(H2,15,16,23)/t8?,9-/m0/s1 |
| InChIKey | HEQMLQIDYWOZTR-GKAPJAKFSA-N |
| XLogP | -0.55 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|