C13H21N3O5 — CID 162474842
(2S)-2-[[(1S)-1-carboxybut-3-ynyl]carbamoylamino]-6-(methylamino)hexanoic acid (PubChem CID 162474842) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxybut-3-ynyl]carbamoylamino]-6-(methylamino)hexanoic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxybut-3-ynyl]carbamoylamino]-6-(methylamino)hexanoic acid |
|---|---|
| PubChem CID | 162474842 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxybut-3-ynyl]carbamoylamino]-6-(methylamino)hexanoic acid |
| SMILES | C#CC[C@H](NC(=O)N[C@@H](CCCCNC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H21N3O5/c1-3-6-9(11(17)18)15-13(21)16-10(12(19)20)7-4-5-8-14-2/h1,9-10,14H,4-8H2,2H3,(H,17,18)(H,19,20)(H2,15,16,21)/t9-,10-/m0/s1 |
| InChIKey | JVOFCYYKYLEIME-UWVGGRQHSA-N |
| XLogP | -0.40 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|