C6H8N2O3 — CID 56660957
2-(carbamoylamino)pent-4-ynoic acid (PubChem CID 56660957) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is 2-(carbamoylamino)pent-4-ynoic acid.
| Compound Name | 2-(carbamoylamino)pent-4-ynoic acid |
|---|---|
| PubChem CID | 56660957 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 2-(carbamoylamino)pent-4-ynoic acid |
| SMILES | C#CCC(NC(N)=O)C(=O)O |
| InChI | InChI=1S/C6H8N2O3/c1-2-3-4(5(9)10)8-6(7)11/h1,4H,3H2,(H,9,10)(H3,7,8,11) |
| InChIKey | XUGMQQUINNIARE-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|