C12H11NO5 — CID 107702805
2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid (PubChem CID 107702805) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is 2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid.
| Compound Name | 2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 107702805 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid |
| SMILES | C#CCC(NC(=O)c1cc(O)cc(O)c1)C(=O)O |
| InChI | InChI=1S/C12H11NO5/c1-2-3-10(12(17)18)13-11(16)7-4-8(14)6-9(15)5-7/h1,4-6,10,14-15H,3H2,(H,13,16)(H,17,18) |
| InChIKey | BDVQTIMAJBOQFI-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|