2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid

C12H11NO5 — CID 107702805

IUPAC2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid
SMILESC#CCC(NC(=O)c1cc(O)cc(O)c1)C(=O)O
InChIInChI=1S/C12H11NO5/c1-2-3-10(12(17)18)13-11(16)7-4-8(14)6-9(15)5-7/h1,4-6,10,14-15H,3H2,(H,13,16)(H,17,18)
InChIKeyBDVQTIMAJBOQFI-UHFFFAOYSA-N
MW249.22 g/mol
LogP0.30
Rot. Bonds4

About 2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid

2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid (PubChem CID 107702805) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is 2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid.

Molecular Properties

Compound Name2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid
PubChem CID107702805
Molecular FormulaC12H11NO5
Molecular Weight249.22 g/mol
Exact Mass249.06
IUPAC Name2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid
SMILESC#CCC(NC(=O)c1cc(O)cc(O)c1)C(=O)O
InChIInChI=1S/C12H11NO5/c1-2-3-10(12(17)18)13-11(16)7-4-8(14)6-9(15)5-7/h1,4-6,10,14-15H,3H2,(H,13,16)(H,17,18)
InChIKeyBDVQTIMAJBOQFI-UHFFFAOYSA-N
XLogP0.30
TPSA106.86 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.22
LogP ≤ 50.30
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid?
The IUPAC name of 2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid (CID 107702805) is 2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid.
What is the SMILES notation for 2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid?
The canonical SMILES for 2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid is C#CCC(NC(=O)c1cc(O)cc(O)c1)C(=O)O.
What is the InChIKey of 2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid?
The InChIKey is BDVQTIMAJBOQFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO5/c1-2-3-10(12(17)18)13-11(16)7-4-8(14)6-9(15)5-7/h1,4-6,10,14-15H,3H2,(H,13,16)(H,17,18).
What are the key properties of 2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid?
2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid has a molecular weight of 249.22 g/mol, XLogP of 0.30, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dihydroxybenzoyl)amino]pent-4-ynoic acid is sourced from PubChem (CID 107702805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).