C13H19NO3 — CID 91649720
3,5-dihydroxy-N-(4-methylpentan-2-yl)benzamide (PubChem CID 91649720) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3,5-dihydroxy-N-(4-methylpentan-2-yl)benzamide.
| Compound Name | 3,5-dihydroxy-N-(4-methylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 91649720 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 3,5-dihydroxy-N-(4-methylpentan-2-yl)benzamide |
| SMILES | CC(C)CC(C)NC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C13H19NO3/c1-8(2)4-9(3)14-13(17)10-5-11(15)7-12(16)6-10/h5-9,15-16H,4H2,1-3H3,(H,14,17) |
| InChIKey | AKBCVYGAELOFNR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |