C15H17NO4 — CID 104938782
N-[4-(furan-2-yl)butan-2-yl]-3,5-dihydroxybenzamide (PubChem CID 104938782) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is N-[4-(furan-2-yl)butan-2-yl]-3,5-dihydroxybenzamide.
| Compound Name | N-[4-(furan-2-yl)butan-2-yl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 104938782 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-[4-(furan-2-yl)butan-2-yl]-3,5-dihydroxybenzamide |
| SMILES | CC(CCc1ccco1)NC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H17NO4/c1-10(4-5-14-3-2-6-20-14)16-15(19)11-7-12(17)9-13(18)8-11/h2-3,6-10,17-18H,4-5H2,1H3,(H,16,19) |
| InChIKey | NLDWANMOIXMPGA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |