C16H18BrNO2 — CID 102851452
4-(bromomethyl)-N-[4-(furan-2-yl)butan-2-yl]benzamide (PubChem CID 102851452) has the molecular formula C16H18BrNO2 and a molecular weight of 336.23 g/mol. Its IUPAC name is 4-(bromomethyl)-N-[4-(furan-2-yl)butan-2-yl]benzamide.
| Compound Name | 4-(bromomethyl)-N-[4-(furan-2-yl)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 102851452 |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 4-(bromomethyl)-N-[4-(furan-2-yl)butan-2-yl]benzamide |
| SMILES | CC(CCc1ccco1)NC(=O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C16H18BrNO2/c1-12(4-9-15-3-2-10-20-15)18-16(19)14-7-5-13(11-17)6-8-14/h2-3,5-8,10,12H,4,9,11H2,1H3,(H,18,19) |
| InChIKey | PWQDBAYWXRKVPB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|