C19H20N2O4 — CID 39948589
4-(2,5-dioxopyrrolidin-1-yl)-N-[(2R)-4-(furan-2-yl)butan-2-yl]benzamide (PubChem CID 39948589) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-[(2R)-4-(furan-2-yl)butan-2-yl]benzamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[(2R)-4-(furan-2-yl)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 39948589 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[(2R)-4-(furan-2-yl)butan-2-yl]benzamide |
| SMILES | C[C@H](CCc1ccco1)NC(=O)c1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C19H20N2O4/c1-13(4-9-16-3-2-12-25-16)20-19(24)14-5-7-15(8-6-14)21-17(22)10-11-18(21)23/h2-3,5-8,12-13H,4,9-11H2,1H3,(H,20,24)/t13-/m1/s1 |
| InChIKey | ZIZJHGNRRXDJEZ-CYBMUJFWSA-N |
| XLogP | 2.68 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|