C16H19NO4S — CID 18162440
N-[4-(furan-2-yl)butan-2-yl]-3-methylsulfonylbenzamide (PubChem CID 18162440) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-[4-(furan-2-yl)butan-2-yl]-3-methylsulfonylbenzamide.
| Compound Name | N-[4-(furan-2-yl)butan-2-yl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 18162440 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-[4-(furan-2-yl)butan-2-yl]-3-methylsulfonylbenzamide |
| SMILES | CC(CCc1ccco1)NC(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H19NO4S/c1-12(8-9-14-6-4-10-21-14)17-16(18)13-5-3-7-15(11-13)22(2,19)20/h3-7,10-12H,8-9H2,1-2H3,(H,17,18) |
| InChIKey | IIKKHPKFDVILIT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |