C20H22N2O4S2 — CID 55364025
N-[4-(furan-2-yl)butan-2-yl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide (PubChem CID 55364025) has the molecular formula C20H22N2O4S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[4-(furan-2-yl)butan-2-yl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[4-(furan-2-yl)butan-2-yl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55364025 |
| Molecular Formula | C20H22N2O4S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | N-[4-(furan-2-yl)butan-2-yl]-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
| SMILES | CC(CCc1ccco1)NC(=O)c1cccc(S(=O)(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C20H22N2O4S2/c1-15(9-10-17-6-3-11-26-17)22-20(23)16-5-2-8-19(13-16)28(24,25)21-14-18-7-4-12-27-18/h2-8,11-13,15,21H,9-10,14H2,1H3,(H,22,23) |
| InChIKey | QTHUUKDCTFGULV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |