C17H21N3O3S2 — CID 119612805
N-(2-amino-1-cyclopropylethyl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide (PubChem CID 119612805) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 119612805 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-3-(thiophen-2-ylmethylsulfamoyl)benzamide |
| SMILES | NCC(NC(=O)c1cccc(S(=O)(=O)NCc2cccs2)c1)C1CC1 |
| InChI | InChI=1S/C17H21N3O3S2/c18-10-16(12-6-7-12)20-17(21)13-3-1-5-15(9-13)25(22,23)19-11-14-4-2-8-24-14/h1-5,8-9,12,16,19H,6-7,10-11,18H2,(H,20,21) |
| InChIKey | CYUQBPHKJDEPTJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |