C16H23N3O4S — CID 119615604
N-(2-amino-1-cyclopropylethyl)-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 119615604) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 119615604 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | NCC(NC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1)C1CC1 |
| InChI | InChI=1S/C16H23N3O4S/c17-11-15(12-4-5-12)18-16(20)13-2-1-3-14(10-13)24(21,22)19-6-8-23-9-7-19/h1-3,10,12,15H,4-9,11,17H2,(H,18,20) |
| InChIKey | YQASFACXNHTFRO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |