C24H34N2O4S — CID 43011512
N-[1-(1-adamantyl)propyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 43011512) has the molecular formula C24H34N2O4S and a molecular weight of 446.61 g/mol. Its IUPAC name is N-[1-(1-adamantyl)propyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[1-(1-adamantyl)propyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 43011512 |
| Molecular Formula | C24H34N2O4S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-[1-(1-adamantyl)propyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCC(NC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H34N2O4S/c1-2-22(24-14-17-10-18(15-24)12-19(11-17)16-24)25-23(27)20-4-3-5-21(13-20)31(28,29)26-6-8-30-9-7-26/h3-5,13,17-19,22H,2,6-12,14-16H2,1H3,(H,25,27) |
| InChIKey | HXJYJTXXUOYRSB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |