C24H35N3O3S — CID 42989962
N-[1-(1-adamantyl)ethyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 42989962) has the molecular formula C24H35N3O3S and a molecular weight of 445.63 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 42989962 |
| Molecular Formula | C24H35N3O3S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | CC(NC(=O)c1cccc(S(=O)(=O)N2CCN(C)CC2)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H35N3O3S/c1-17(24-14-18-10-19(15-24)12-20(11-18)16-24)25-23(28)21-4-3-5-22(13-21)31(29,30)27-8-6-26(2)7-9-27/h3-5,13,17-20H,6-12,14-16H2,1-2H3,(H,25,28) |
| InChIKey | OYXOEWHWYKRPBZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |