C22H28FN3O3S — CID 39968266
N-[(1S)-1-(4-fluorophenyl)-2-methylpropyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 39968266) has the molecular formula C22H28FN3O3S and a molecular weight of 433.55 g/mol. Its IUPAC name is N-[(1S)-1-(4-fluorophenyl)-2-methylpropyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-[(1S)-1-(4-fluorophenyl)-2-methylpropyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 39968266 |
| Molecular Formula | C22H28FN3O3S |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-[(1S)-1-(4-fluorophenyl)-2-methylpropyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1cccc(S(=O)(=O)N2CCN(C)CC2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H28FN3O3S/c1-16(2)21(17-7-9-19(23)10-8-17)24-22(27)18-5-4-6-20(15-18)30(28,29)26-13-11-25(3)12-14-26/h4-10,15-16,21H,11-14H2,1-3H3,(H,24,27)/t21-/m0/s1 |
| InChIKey | OZYIMSHRKWNGHA-NRFANRHFSA-N |
| XLogP | 2.89 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |