C19H18FN3O3S — CID 9246301
N-[(R)-cyano-(4-fluorophenyl)methyl]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 9246301) has the molecular formula C19H18FN3O3S and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[(R)-cyano-(4-fluorophenyl)methyl]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(R)-cyano-(4-fluorophenyl)methyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 9246301 |
| Molecular Formula | C19H18FN3O3S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-[(R)-cyano-(4-fluorophenyl)methyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | N#C[C@H](NC(=O)c1cccc(S(=O)(=O)N2CCCC2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H18FN3O3S/c20-16-8-6-14(7-9-16)18(13-21)22-19(24)15-4-3-5-17(12-15)27(25,26)23-10-1-2-11-23/h3-9,12,18H,1-2,10-11H2,(H,22,24)/t18-/m0/s1 |
| InChIKey | YDNVRYRKWCEVHT-SFHVURJKSA-N |
| XLogP | 2.60 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |