C24H25FN4O3S — CID 112761324
3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-N-(1-pyridin-4-ylethyl)benzamide (PubChem CID 112761324) has the molecular formula C24H25FN4O3S and a molecular weight of 468.55 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-N-(1-pyridin-4-ylethyl)benzamide.
| Compound Name | 3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-N-(1-pyridin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 112761324 |
| Molecular Formula | C24H25FN4O3S |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl-N-(1-pyridin-4-ylethyl)benzamide |
| SMILES | CC(NC(=O)c1cccc(S(=O)(=O)N2CCN(c3ccc(F)cc3)CC2)c1)c1ccncc1 |
| InChI | InChI=1S/C24H25FN4O3S/c1-18(19-9-11-26-12-10-19)27-24(30)20-3-2-4-23(17-20)33(31,32)29-15-13-28(14-16-29)22-7-5-21(25)6-8-22/h2-12,17-18H,13-16H2,1H3,(H,27,30) |
| InChIKey | UOPWVRIGCUXARM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |