C25H26FN3O3S — CID 42965111
N-(3-ethylphenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzamide (PubChem CID 42965111) has the molecular formula C25H26FN3O3S and a molecular weight of 467.57 g/mol. Its IUPAC name is N-(3-ethylphenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzamide.
| Compound Name | N-(3-ethylphenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 42965111 |
| Molecular Formula | C25H26FN3O3S |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | N-(3-ethylphenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzamide |
| SMILES | CCc1cccc(NC(=O)c2cccc(S(=O)(=O)N3CCN(c4ccc(F)cc4)CC3)c2)c1 |
| InChI | InChI=1S/C25H26FN3O3S/c1-2-19-5-3-7-22(17-19)27-25(30)20-6-4-8-24(18-20)33(31,32)29-15-13-28(14-16-29)23-11-9-21(26)10-12-23/h3-12,17-18H,2,13-16H2,1H3,(H,27,30) |
| InChIKey | SUKVIQDINZEFAA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |